C22H22NOP — CID 101226824
(1R)-1-cyclopropyl-N-diphenylphosphoryl-1-phenylmethanamine (PubChem CID 101226824) has the molecular formula C22H22NOP and a molecular weight of 347.40 g/mol. Its IUPAC name is (1R)-1-cyclopropyl-N-diphenylphosphoryl-1-phenylmethanamine.
| Compound Name | (1R)-1-cyclopropyl-N-diphenylphosphoryl-1-phenylmethanamine |
|---|---|
| PubChem CID | 101226824 |
| Molecular Formula | C22H22NOP |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | (1R)-1-cyclopropyl-N-diphenylphosphoryl-1-phenylmethanamine |
| SMILES | O=P(N[C@@H](c1ccccc1)C1CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22NOP/c24-25(20-12-6-2-7-13-20,21-14-8-3-9-15-21)23-22(19-16-17-19)18-10-4-1-5-11-18/h1-15,19,22H,16-17H2,(H,23,24)/t22-/m0/s1 |
| InChIKey | HVCNOKZFBPVCIU-QFIPXVFZSA-N |
| XLogP | 4.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|