C30H29N2O2P — CID 21014157
cis-(1S,2R)-N-benzyl-2-[(S)-(diphenylphosphorylamino)-phenylmethyl]cyclopropane-1-carboxamide (PubChem CID 21014157) has the molecular formula C30H29N2O2P and a molecular weight of 480.55 g/mol. Its IUPAC name is cis-(1S,2R)-N-benzyl-2-[(S)-(diphenylphosphorylamino)-phenylmethyl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-benzyl-2-[(S)-(diphenylphosphorylamino)-phenylmethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 21014157 |
| Molecular Formula | C30H29N2O2P |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | cis-(1S,2R)-N-benzyl-2-[(S)-(diphenylphosphorylamino)-phenylmethyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@H]1C[C@H]1[C@H](NP(=O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H29N2O2P/c33-30(31-22-23-13-5-1-6-14-23)28-21-27(28)29(24-15-7-2-8-16-24)32-35(34,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20,27-29H,21-22H2,(H,31,33)(H,32,34)/t27-,28+,29-/m1/s1 |
| InChIKey | UFFCTWJAUYAWNT-SSBOKUKZSA-N |
| XLogP | 5.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|