C19H20N2O2 — CID 99792858
N-benzyl-N'-[(R)-cyclopropyl(phenyl)methyl]oxamide (PubChem CID 99792858) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-benzyl-N'-[(R)-cyclopropyl(phenyl)methyl]oxamide.
| Compound Name | N-benzyl-N'-[(R)-cyclopropyl(phenyl)methyl]oxamide |
|---|---|
| PubChem CID | 99792858 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-benzyl-N'-[(R)-cyclopropyl(phenyl)methyl]oxamide |
| SMILES | O=C(NCc1ccccc1)C(=O)N[C@@H](c1ccccc1)C1CC1 |
| InChI | InChI=1S/C19H20N2O2/c22-18(20-13-14-7-3-1-4-8-14)19(23)21-17(16-11-12-16)15-9-5-2-6-10-15/h1-10,16-17H,11-13H2,(H,20,22)(H,21,23)/t17-/m0/s1 |
| InChIKey | JKSGUTHFDUJQJZ-KRWDZBQOSA-N |
| XLogP | 2.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|