C25H14F8NOP — CID 102369214
2,3,4,5,6-pentafluoro-N-[phenyl-[2-[4-(trifluoromethyl)phenyl]phenyl]phosphoryl]aniline (PubChem CID 102369214) has the molecular formula C25H14F8NOP and a molecular weight of 527.35 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[phenyl-[2-[4-(trifluoromethyl)phenyl]phenyl]phosphoryl]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[phenyl-[2-[4-(trifluoromethyl)phenyl]phenyl]phosphoryl]aniline |
|---|---|
| PubChem CID | 102369214 |
| Molecular Formula | C25H14F8NOP |
| Molecular Weight | 527.35 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[phenyl-[2-[4-(trifluoromethyl)phenyl]phenyl]phosphoryl]aniline |
| SMILES | O=P(Nc1c(F)c(F)c(F)c(F)c1F)(c1ccccc1)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H14F8NOP/c26-19-20(27)22(29)24(23(30)21(19)28)34-36(35,16-6-2-1-3-7-16)18-9-5-4-8-17(18)14-10-12-15(13-11-14)25(31,32)33/h1-13H,(H,34,35) |
| InChIKey | NHFZAQMZCFSFLJ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.35 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|