C14H9F3NO2- — CID 152781290
N-[2-[4-(trifluoromethyl)phenyl]phenyl]carbamate (PubChem CID 152781290) has the molecular formula C14H9F3NO2- and a molecular weight of 280.23 g/mol. Its IUPAC name is N-[2-[4-(trifluoromethyl)phenyl]phenyl]carbamate.
| Compound Name | N-[2-[4-(trifluoromethyl)phenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 152781290 |
| Molecular Formula | C14H9F3NO2- |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | N-[2-[4-(trifluoromethyl)phenyl]phenyl]carbamate |
| SMILES | O=C([O-])Nc1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H10F3NO2/c15-14(16,17)10-7-5-9(6-8-10)11-3-1-2-4-12(11)18-13(19)20/h1-8,18H,(H,19,20)/p-1 |
| InChIKey | IGRSYXMTPUXDOZ-UHFFFAOYSA-M |
| XLogP | 3.13 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |