C24H15F5NOP — CID 102369204
2,3,4,5,6-pentafluoro-N-[phenyl-(2-phenylphenyl)phosphoryl]aniline (PubChem CID 102369204) has the molecular formula C24H15F5NOP and a molecular weight of 459.35 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[phenyl-(2-phenylphenyl)phosphoryl]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[phenyl-(2-phenylphenyl)phosphoryl]aniline |
|---|---|
| PubChem CID | 102369204 |
| Molecular Formula | C24H15F5NOP |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[phenyl-(2-phenylphenyl)phosphoryl]aniline |
| SMILES | O=P(Nc1c(F)c(F)c(F)c(F)c1F)(c1ccccc1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H15F5NOP/c25-19-20(26)22(28)24(23(29)21(19)27)30-32(31,16-11-5-2-6-12-16)18-14-8-7-13-17(18)15-9-3-1-4-10-15/h1-14H,(H,30,31) |
| InChIKey | UXGKCQLYJKZRNK-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|