C27H18F8NO3P — CID 132504760
2,3,4,5,6-pentafluoro-N-[(3-methoxyphenyl)-[5-methoxy-2-[3-(trifluoromethyl)phenyl]phenyl]phosphoryl]aniline (PubChem CID 132504760) has the molecular formula C27H18F8NO3P and a molecular weight of 587.40 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(3-methoxyphenyl)-[5-methoxy-2-[3-(trifluoromethyl)phenyl]phenyl]phosphoryl]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(3-methoxyphenyl)-[5-methoxy-2-[3-(trifluoromethyl)phenyl]phenyl]phosphoryl]aniline |
|---|---|
| PubChem CID | 132504760 |
| Molecular Formula | C27H18F8NO3P |
| Molecular Weight | 587.40 g/mol |
| Exact Mass | 587.09 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(3-methoxyphenyl)-[5-methoxy-2-[3-(trifluoromethyl)phenyl]phenyl]phosphoryl]aniline |
| SMILES | COc1cccc(P(=O)(Nc2c(F)c(F)c(F)c(F)c2F)c2cc(OC)ccc2-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C27H18F8NO3P/c1-38-16-7-4-8-18(12-16)40(37,36-26-24(31)22(29)21(28)23(30)25(26)32)20-13-17(39-2)9-10-19(20)14-5-3-6-15(11-14)27(33,34)35/h3-13H,1-2H3,(H,36,37) |
| InChIKey | PYLKQLVTJMMTKY-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.40 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|