C24H11F10N2P — CID 86033808
2,3,4,5,6-pentafluoro-N-[(2,3,4,5,6-pentafluorophenyl)imino-diphenyl-λ5-phosphanyl]aniline (PubChem CID 86033808) has the molecular formula C24H11F10N2P and a molecular weight of 548.32 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(2,3,4,5,6-pentafluorophenyl)imino-diphenyl-λ5-phosphanyl]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(2,3,4,5,6-pentafluorophenyl)imino-diphenyl-λ5-phosphanyl]aniline |
|---|---|
| PubChem CID | 86033808 |
| Molecular Formula | C24H11F10N2P |
| Molecular Weight | 548.32 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(2,3,4,5,6-pentafluorophenyl)imino-diphenyl-λ5-phosphanyl]aniline |
| SMILES | Fc1c(F)c(F)c(N=P(Nc2c(F)c(F)c(F)c(F)c2F)(c2ccccc2)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C24H11F10N2P/c25-13-15(27)19(31)23(20(32)16(13)28)35-37(11-7-3-1-4-8-11,12-9-5-2-6-10-12)36-24-21(33)17(29)14(26)18(30)22(24)34/h1-10,35H |
| InChIKey | RITOJVAPBBSCQU-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.32 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|