C15H11F5N2 — CID 9466517
2,3,4,5,6-pentafluoro-N-[(Z)-3-phenylpropylideneamino]aniline (PubChem CID 9466517) has the molecular formula C15H11F5N2 and a molecular weight of 314.26 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(Z)-3-phenylpropylideneamino]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(Z)-3-phenylpropylideneamino]aniline |
|---|---|
| PubChem CID | 9466517 |
| Molecular Formula | C15H11F5N2 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(Z)-3-phenylpropylideneamino]aniline |
| SMILES | Fc1c(F)c(F)c(N/N=C\CCc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C15H11F5N2/c16-10-11(17)13(19)15(14(20)12(10)18)22-21-8-4-7-9-5-2-1-3-6-9/h1-3,5-6,8,22H,4,7H2/b21-8- |
| InChIKey | KVGMGVUOLOECSV-WNFQYIGGSA-N |
| XLogP | 4.41 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|