C54H45N3P3Si — CID 78061620
1,1,1,5,5,5-Hexaphenyl-3-[(triphenyl-lambda~5~-phosphanylidene)amino]-2,4-diaza-1lambda~5~,5lambda~5~-diphospha-3-silapenta-1,4-diene (PubChem CID 78061620) has the molecular formula C54H45N3P3Si and a molecular weight of 856.98 g/mol.
| Compound Name | 1,1,1,5,5,5-Hexaphenyl-3-[(triphenyl-lambda~5~-phosphanylidene)amino]-2,4-diaza-1lambda~5~,5lambda~5~-diphospha-3-silapenta-1,4-diene |
|---|---|
| PubChem CID | 78061620 |
| Molecular Formula | C54H45N3P3Si |
| Molecular Weight | 856.98 g/mol |
| Exact Mass | 856.26 |
| IUPAC Name | — |
| SMILES | c1ccc(P(=N[Si](N=P(c2ccccc2)(c2ccccc2)c2ccccc2)N=P(c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C54H45N3P3Si/c1-10-28-46(29-11-1)58(47-30-12-2-13-31-47,48-32-14-3-15-33-48)55-61(56-59(49-34-16-4-17-35-49,50-36-18-5-19-37-50)51-38-20-6-21-39-51)57-60(52-40-22-7-23-41-52,53-42-24-8-25-43-53)54-44-26-9-27-45-54/h1-45H |
| InChIKey | WNJVTBKEQLAYOH-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.98 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|