About [chloro(diphenyl)-λ4-sulfanyl]imino-triphenyl-λ5-phosphane
[chloro(diphenyl)-λ4-sulfanyl]imino-triphenyl-λ5-phosphane (PubChem CID 134935311) has the molecular formula C30H25ClNPS
and a molecular weight of 498.03 g/mol. Its IUPAC name is [chloro(diphenyl)-λ4-sulfanyl]imino-triphenyl-λ5-phosphane.
Molecular Properties
| Compound Name | [chloro(diphenyl)-λ4-sulfanyl]imino-triphenyl-λ5-phosphane |
| PubChem CID | 134935311 |
| Molecular Formula | C30H25ClNPS |
| Molecular Weight | 498.03 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | [chloro(diphenyl)-λ4-sulfanyl]imino-triphenyl-λ5-phosphane |
| SMILES | ClS(N=P(c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H25ClNPS/c31-34(29-22-12-4-13-23-29,30-24-14-5-15-25-30)32-33(26-16-6-1-7-17-26,27-18-8-2-9-19-27)28-20-10-3-11-21-28/h1-25H |
| InChIKey | NKLZTLJLONSXSX-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.03 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [chloro(diphenyl)-λ4-sulfanyl]imino-triphenyl-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [chloro(diphenyl)-λ4-sulfanyl]imino-triphenyl-λ5-phosphane?
The IUPAC name of [chloro(diphenyl)-λ4-sulfanyl]imino-triphenyl-λ5-phosphane (CID 134935311) is [chloro(diphenyl)-λ4-sulfanyl]imino-triphenyl-λ5-phosphane.
What is the SMILES notation for [chloro(diphenyl)-λ4-sulfanyl]imino-triphenyl-λ5-phosphane?
The canonical SMILES for [chloro(diphenyl)-λ4-sulfanyl]imino-triphenyl-λ5-phosphane is ClS(N=P(c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [chloro(diphenyl)-λ4-sulfanyl]imino-triphenyl-λ5-phosphane?
The InChIKey is NKLZTLJLONSXSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H25ClNPS/c31-34(29-22-12-4-13-23-29,30-24-14-5-15-25-30)32-33(26-16-6-1-7-17-26,27-18-8-2-9-19-27)28-20-10-3-11-21-28/h1-25H.
What are the key properties of [chloro(diphenyl)-λ4-sulfanyl]imino-triphenyl-λ5-phosphane?
[chloro(diphenyl)-λ4-sulfanyl]imino-triphenyl-λ5-phosphane has a molecular weight of 498.03 g/mol, XLogP of 8.16, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [chloro(diphenyl)-λ4-sulfanyl]imino-triphenyl-λ5-phosphane is sourced from PubChem (CID 134935311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).