About [dichloro(phenyl)-λ4-sulfanyl]phosphonic acid
[dichloro(phenyl)-λ4-sulfanyl]phosphonic acid (PubChem CID 57230559) has the molecular formula C6H7Cl2O3PS
and a molecular weight of 261.07 g/mol. Its IUPAC name is [dichloro(phenyl)-λ4-sulfanyl]phosphonic acid.
Molecular Properties
| Compound Name | [dichloro(phenyl)-λ4-sulfanyl]phosphonic acid |
| PubChem CID | 57230559 |
| Molecular Formula | C6H7Cl2O3PS |
| Molecular Weight | 261.07 g/mol |
| Exact Mass | 259.92 |
| IUPAC Name | [dichloro(phenyl)-λ4-sulfanyl]phosphonic acid |
| SMILES | O=P(O)(O)S(Cl)(Cl)c1ccccc1 |
| InChI | InChI=1S/C6H7Cl2O3PS/c7-13(8,12(9,10)11)6-4-2-1-3-5-6/h1-5H,(H2,9,10,11) |
| InChIKey | JDSCZOATALGQTK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.07 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [dichloro(phenyl)-λ4-sulfanyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dichloro(phenyl)-λ4-sulfanyl]phosphonic acid?
The IUPAC name of [dichloro(phenyl)-λ4-sulfanyl]phosphonic acid (CID 57230559) is [dichloro(phenyl)-λ4-sulfanyl]phosphonic acid.
What is the SMILES notation for [dichloro(phenyl)-λ4-sulfanyl]phosphonic acid?
The canonical SMILES for [dichloro(phenyl)-λ4-sulfanyl]phosphonic acid is O=P(O)(O)S(Cl)(Cl)c1ccccc1.
What is the InChIKey of [dichloro(phenyl)-λ4-sulfanyl]phosphonic acid?
The InChIKey is JDSCZOATALGQTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7Cl2O3PS/c7-13(8,12(9,10)11)6-4-2-1-3-5-6/h1-5H,(H2,9,10,11).
What are the key properties of [dichloro(phenyl)-λ4-sulfanyl]phosphonic acid?
[dichloro(phenyl)-λ4-sulfanyl]phosphonic acid has a molecular weight of 261.07 g/mol, XLogP of 3.25, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [dichloro(phenyl)-λ4-sulfanyl]phosphonic acid is sourced from PubChem (CID 57230559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).