phenylalumane;phosphoric acid

C6H10AlO4P — CID 174850523

IUPACphenylalumane;phosphoric acid
SMILESO=P(O)(O)O.[AlH2]c1ccccc1
InChIInChI=1S/C6H5.Al.H3O4P.2H/c1-2-4-6-5-3-1;;1-5(2,3)4;;/h1-5H;;(H3,1,2,3,4);;
InChIKeyGVOJQEYXPIJVKV-UHFFFAOYSA-N
MW204.10 g/mol
LogP-0.98
Rot. Bonds

About phenylalumane;phosphoric acid

phenylalumane;phosphoric acid (PubChem CID 174850523) has the molecular formula C6H10AlO4P and a molecular weight of 204.10 g/mol. Its IUPAC name is phenylalumane;phosphoric acid.

Molecular Properties

Compound Namephenylalumane;phosphoric acid
PubChem CID174850523
Molecular FormulaC6H10AlO4P
Molecular Weight204.10 g/mol
Exact Mass204.01
IUPAC Namephenylalumane;phosphoric acid
SMILESO=P(O)(O)O.[AlH2]c1ccccc1
InChIInChI=1S/C6H5.Al.H3O4P.2H/c1-2-4-6-5-3-1;;1-5(2,3)4;;/h1-5H;;(H3,1,2,3,4);;
InChIKeyGVOJQEYXPIJVKV-UHFFFAOYSA-N
XLogP-0.98
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.10
LogP ≤ 5-0.98
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze phenylalumane;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of phenylalumane;phosphoric acid?
The IUPAC name of phenylalumane;phosphoric acid (CID 174850523) is phenylalumane;phosphoric acid.
What is the SMILES notation for phenylalumane;phosphoric acid?
The canonical SMILES for phenylalumane;phosphoric acid is O=P(O)(O)O.[AlH2]c1ccccc1.
What is the InChIKey of phenylalumane;phosphoric acid?
The InChIKey is GVOJQEYXPIJVKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5.Al.H3O4P.2H/c1-2-4-6-5-3-1;;1-5(2,3)4;;/h1-5H;;(H3,1,2,3,4);;.
What are the key properties of phenylalumane;phosphoric acid?
phenylalumane;phosphoric acid has a molecular weight of 204.10 g/mol, XLogP of -0.98, 0 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenylalumane;phosphoric acid is sourced from PubChem (CID 174850523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).