About phenylalumane;phosphoric acid
phenylalumane;phosphoric acid (PubChem CID 174850523) has the molecular formula C6H10AlO4P
and a molecular weight of 204.10 g/mol. Its IUPAC name is phenylalumane;phosphoric acid.
Molecular Properties
| Compound Name | phenylalumane;phosphoric acid |
| PubChem CID | 174850523 |
| Molecular Formula | C6H10AlO4P |
| Molecular Weight | 204.10 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | phenylalumane;phosphoric acid |
| SMILES | O=P(O)(O)O.[AlH2]c1ccccc1 |
| InChI | InChI=1S/C6H5.Al.H3O4P.2H/c1-2-4-6-5-3-1;;1-5(2,3)4;;/h1-5H;;(H3,1,2,3,4);; |
| InChIKey | GVOJQEYXPIJVKV-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.10 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phenylalumane;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylalumane;phosphoric acid?
The IUPAC name of phenylalumane;phosphoric acid (CID 174850523) is phenylalumane;phosphoric acid.
What is the SMILES notation for phenylalumane;phosphoric acid?
The canonical SMILES for phenylalumane;phosphoric acid is O=P(O)(O)O.[AlH2]c1ccccc1.
What is the InChIKey of phenylalumane;phosphoric acid?
The InChIKey is GVOJQEYXPIJVKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5.Al.H3O4P.2H/c1-2-4-6-5-3-1;;1-5(2,3)4;;/h1-5H;;(H3,1,2,3,4);;.
What are the key properties of phenylalumane;phosphoric acid?
phenylalumane;phosphoric acid has a molecular weight of 204.10 g/mol, XLogP of -0.98, 0 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenylalumane;phosphoric acid is sourced from PubChem (CID 174850523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).