C22H15F9NP — CID 134984617
[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]imino-triphenyl-λ5-phosphane (PubChem CID 134984617) has the molecular formula C22H15F9NP and a molecular weight of 495.33 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]imino-triphenyl-λ5-phosphane.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]imino-triphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 134984617 |
| Molecular Formula | C22H15F9NP |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]imino-triphenyl-λ5-phosphane |
| SMILES | FC(F)(F)C(N=P(c1ccccc1)(c1ccccc1)c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H15F9NP/c23-20(24,25)19(21(26,27)28,22(29,30)31)32-33(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | QYNJCUXUTMTLQX-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|