C8H6F5S+ — CID 151139469
1,1,2,2,2-pentafluoroethyl(phenyl)sulfanium (PubChem CID 151139469) has the molecular formula C8H6F5S+ and a molecular weight of 229.19 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoroethyl(phenyl)sulfanium.
| Compound Name | 1,1,2,2,2-pentafluoroethyl(phenyl)sulfanium |
|---|---|
| PubChem CID | 151139469 |
| Molecular Formula | C8H6F5S+ |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 1,1,2,2,2-pentafluoroethyl(phenyl)sulfanium |
| SMILES | FC(F)(F)C(F)(F)[SH+]c1ccccc1 |
| InChI | InChI=1S/C8H5F5S/c9-7(10,11)8(12,13)14-6-4-2-1-3-5-6/h1-5H/p+1 |
| InChIKey | MVWOBQJDBOYETE-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|