C8H6F5OP — CID 175406720
1,1,2,2,2-pentafluoroethyl(phenoxy)phosphane (PubChem CID 175406720) has the molecular formula C8H6F5OP and a molecular weight of 244.10 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoroethyl(phenoxy)phosphane.
| Compound Name | 1,1,2,2,2-pentafluoroethyl(phenoxy)phosphane |
|---|---|
| PubChem CID | 175406720 |
| Molecular Formula | C8H6F5OP |
| Molecular Weight | 244.10 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 1,1,2,2,2-pentafluoroethyl(phenoxy)phosphane |
| SMILES | FC(F)(F)C(F)(F)POc1ccccc1 |
| InChI | InChI=1S/C8H6F5OP/c9-7(10,11)8(12,13)15-14-6-4-2-1-3-5-6/h1-5,15H |
| InChIKey | IIVOPLOQTKSMBI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.10 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|