About diphenoxyphosphane chloride
diphenoxyphosphane chloride (PubChem CID 19706010) has the molecular formula C12H11ClO2P-
and a molecular weight of 253.65 g/mol. Its IUPAC name is diphenoxyphosphane chloride.
Molecular Properties
| Compound Name | diphenoxyphosphane chloride |
| PubChem CID | 19706010 |
| Molecular Formula | C12H11ClO2P- |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | diphenoxyphosphane chloride |
| SMILES | [Cl-].c1ccc(OPOc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11O2P.ClH/c1-3-7-11(8-4-1)13-15-14-12-9-5-2-6-10-12;/h1-10,15H;1H/p-1 |
| InChIKey | CRSHRLBSKCMDCB-UHFFFAOYSA-M |
| XLogP | 0.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenoxyphosphane chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenoxyphosphane chloride?
The IUPAC name of diphenoxyphosphane chloride (CID 19706010) is diphenoxyphosphane chloride.
What is the SMILES notation for diphenoxyphosphane chloride?
The canonical SMILES for diphenoxyphosphane chloride is [Cl-].c1ccc(OPOc2ccccc2)cc1.
What is the InChIKey of diphenoxyphosphane chloride?
The InChIKey is CRSHRLBSKCMDCB-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H11O2P.ClH/c1-3-7-11(8-4-1)13-15-14-12-9-5-2-6-10-12;/h1-10,15H;1H/p-1.
What are the key properties of diphenoxyphosphane chloride?
diphenoxyphosphane chloride has a molecular weight of 253.65 g/mol, XLogP of 0.66, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenoxyphosphane chloride is sourced from PubChem (CID 19706010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).