C28H37O6P — CID 175207200
benzoic acid;2,6-dimethylheptane-3,5-diol;diphenoxyphosphane (PubChem CID 175207200) has the molecular formula C28H37O6P and a molecular weight of 500.57 g/mol. Its IUPAC name is benzoic acid;2,6-dimethylheptane-3,5-diol;diphenoxyphosphane.
| Compound Name | benzoic acid;2,6-dimethylheptane-3,5-diol;diphenoxyphosphane |
|---|---|
| PubChem CID | 175207200 |
| Molecular Formula | C28H37O6P |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | benzoic acid;2,6-dimethylheptane-3,5-diol;diphenoxyphosphane |
| SMILES | CC(C)C(O)CC(O)C(C)C.O=C(O)c1ccccc1.c1ccc(OPOc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11O2P.C9H20O2.C7H6O2/c1-3-7-11(8-4-1)13-15-14-12-9-5-2-6-10-12;1-6(2)8(10)5-9(11)7(3)4;8-7(9)6-4-2-1-3-5-6/h1-10,15H;6-11H,5H2,1-4H3;1-5H,(H,8,9) |
| InChIKey | IOHIDVGBKCTOHQ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|