C12H20BrOP — CID 175900993
2,3-dimethylbutan-2-yl(phenoxy)phosphane;hydrobromide (PubChem CID 175900993) has the molecular formula C12H20BrOP and a molecular weight of 291.17 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl(phenoxy)phosphane;hydrobromide.
| Compound Name | 2,3-dimethylbutan-2-yl(phenoxy)phosphane;hydrobromide |
|---|---|
| PubChem CID | 175900993 |
| Molecular Formula | C12H20BrOP |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2,3-dimethylbutan-2-yl(phenoxy)phosphane;hydrobromide |
| SMILES | Br.CC(C)C(C)(C)POc1ccccc1 |
| InChI | InChI=1S/C12H19OP.BrH/c1-10(2)12(3,4)14-13-11-8-6-5-7-9-11;/h5-10,14H,1-4H3;1H |
| InChIKey | LYFLCXFWNYUFLO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|