C41H65F3NO3PSi4 — CID 102528620
tris(triethylsilyl)silyl 3-(diphenylphosphorylamino)-2-methyl-3-[4-(trifluoromethyl)phenyl]propanoate (PubChem CID 102528620) has the molecular formula C41H65F3NO3PSi4 and a molecular weight of 820.29 g/mol. Its IUPAC name is tris(triethylsilyl)silyl 3-(diphenylphosphorylamino)-2-methyl-3-[4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | tris(triethylsilyl)silyl 3-(diphenylphosphorylamino)-2-methyl-3-[4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 102528620 |
| Molecular Formula | C41H65F3NO3PSi4 |
| Molecular Weight | 820.29 g/mol |
| Exact Mass | 819.37 |
| IUPAC Name | tris(triethylsilyl)silyl 3-(diphenylphosphorylamino)-2-methyl-3-[4-(trifluoromethyl)phenyl]propanoate |
| SMILES | CC[Si](CC)(CC)[Si](OC(=O)C(C)C(NP(=O)(c1ccccc1)c1ccccc1)c1ccc(C(F)(F)F)cc1)([Si](CC)(CC)CC)[Si](CC)(CC)CC |
| InChI | InChI=1S/C41H65F3NO3PSi4/c1-11-50(12-2,13-3)53(51(14-4,15-5)16-6,52(17-7,18-8)19-9)48-40(46)34(10)39(35-30-32-36(33-31-35)41(42,43)44)45-49(47,37-26-22-20-23-27-37)38-28-24-21-25-29-38/h20-34,39H,11-19H2,1-10H3,(H,45,47) |
| InChIKey | FUZMIABYWIMPLT-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.29 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|