C20H23F3N2O — CID 109031832
3-[benzyl(propan-2-yl)amino]-N-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 109031832) has the molecular formula C20H23F3N2O and a molecular weight of 364.41 g/mol. Its IUPAC name is 3-[benzyl(propan-2-yl)amino]-N-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-[benzyl(propan-2-yl)amino]-N-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 109031832 |
| Molecular Formula | C20H23F3N2O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 3-[benzyl(propan-2-yl)amino]-N-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C)N(CCC(=O)Nc1ccc(C(F)(F)F)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H23F3N2O/c1-15(2)25(14-16-6-4-3-5-7-16)13-12-19(26)24-18-10-8-17(9-11-18)20(21,22)23/h3-11,15H,12-14H2,1-2H3,(H,24,26) |
| InChIKey | SLASAGNLYXPEBF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |