C25H23F3N2O2 — CID 42699567
3-[benzyl-(2-phenylacetyl)amino]-N-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 42699567) has the molecular formula C25H23F3N2O2 and a molecular weight of 440.47 g/mol. Its IUPAC name is 3-[benzyl-(2-phenylacetyl)amino]-N-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-[benzyl-(2-phenylacetyl)amino]-N-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 42699567 |
| Molecular Formula | C25H23F3N2O2 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 3-[benzyl-(2-phenylacetyl)amino]-N-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCN(Cc1ccccc1)C(=O)Cc1ccccc1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H23F3N2O2/c26-25(27,28)21-11-13-22(14-12-21)29-23(31)15-16-30(18-20-9-5-2-6-10-20)24(32)17-19-7-3-1-4-8-19/h1-14H,15-18H2,(H,29,31) |
| InChIKey | NTJGKNRGQHDJGQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |