C19H24FN3O — CID 113220993
N-(5-amino-2-fluorophenyl)-3-[benzyl(propan-2-yl)amino]propanamide (PubChem CID 113220993) has the molecular formula C19H24FN3O and a molecular weight of 329.42 g/mol. Its IUPAC name is N-(5-amino-2-fluorophenyl)-3-[benzyl(propan-2-yl)amino]propanamide.
| Compound Name | N-(5-amino-2-fluorophenyl)-3-[benzyl(propan-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 113220993 |
| Molecular Formula | C19H24FN3O |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | N-(5-amino-2-fluorophenyl)-3-[benzyl(propan-2-yl)amino]propanamide |
| SMILES | CC(C)N(CCC(=O)Nc1cc(N)ccc1F)Cc1ccccc1 |
| InChI | InChI=1S/C19H24FN3O/c1-14(2)23(13-15-6-4-3-5-7-15)11-10-19(24)22-18-12-16(21)8-9-17(18)20/h3-9,12,14H,10-11,13,21H2,1-2H3,(H,22,24) |
| InChIKey | VPUYQYHIEOCZKL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|