C16H23F3N2O3S — CID 113141213
3-[3-methylbutyl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 113141213) has the molecular formula C16H23F3N2O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is 3-[3-methylbutyl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-[3-methylbutyl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 113141213 |
| Molecular Formula | C16H23F3N2O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 3-[3-methylbutyl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C)CCN(CCC(=O)Nc1ccc(C(F)(F)F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C16H23F3N2O3S/c1-12(2)8-10-21(25(3,23)24)11-9-15(22)20-14-6-4-13(5-7-14)16(17,18)19/h4-7,12H,8-11H2,1-3H3,(H,20,22) |
| InChIKey | NXOUXTMOHPJSFN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |