C13H16F3NO2 — CID 66098530
methyl 4-amino-3-[4-(trifluoromethyl)phenyl]pentanoate (PubChem CID 66098530) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is methyl 4-amino-3-[4-(trifluoromethyl)phenyl]pentanoate.
| Compound Name | methyl 4-amino-3-[4-(trifluoromethyl)phenyl]pentanoate |
|---|---|
| PubChem CID | 66098530 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | methyl 4-amino-3-[4-(trifluoromethyl)phenyl]pentanoate |
| SMILES | COC(=O)CC(c1ccc(C(F)(F)F)cc1)C(C)N |
| InChI | InChI=1S/C13H16F3NO2/c1-8(17)11(7-12(18)19-2)9-3-5-10(6-4-9)13(14,15)16/h3-6,8,11H,7,17H2,1-2H3 |
| InChIKey | SCWKPRBLMJTFRW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |