C19H24NO2P — CID 10520391
(3S,4S)-4-(diphenylphosphorylamino)-5-methylhex-1-en-3-ol (PubChem CID 10520391) has the molecular formula C19H24NO2P and a molecular weight of 329.38 g/mol. Its IUPAC name is (3S,4S)-4-(diphenylphosphorylamino)-5-methylhex-1-en-3-ol.
| Compound Name | (3S,4S)-4-(diphenylphosphorylamino)-5-methylhex-1-en-3-ol |
|---|---|
| PubChem CID | 10520391 |
| Molecular Formula | C19H24NO2P |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | (3S,4S)-4-(diphenylphosphorylamino)-5-methylhex-1-en-3-ol |
| SMILES | C=C[C@H](O)[C@@H](NP(=O)(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C19H24NO2P/c1-4-18(21)19(15(2)3)20-23(22,16-11-7-5-8-12-16)17-13-9-6-10-14-17/h4-15,18-19,21H,1H2,2-3H3,(H,20,22)/t18-,19-/m0/s1 |
| InChIKey | VHUGZPNOYHRAMX-OALUTQOASA-N |
| XLogP | 3.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|