C19H23O3P — CID 10336740
(3R,4S,5R)-4-diphenylphosphorylhept-1-ene-3,5-diol (PubChem CID 10336740) has the molecular formula C19H23O3P and a molecular weight of 330.36 g/mol. Its IUPAC name is (3R,4S,5R)-4-diphenylphosphorylhept-1-ene-3,5-diol.
| Compound Name | (3R,4S,5R)-4-diphenylphosphorylhept-1-ene-3,5-diol |
|---|---|
| PubChem CID | 10336740 |
| Molecular Formula | C19H23O3P |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (3R,4S,5R)-4-diphenylphosphorylhept-1-ene-3,5-diol |
| SMILES | C=C[C@@H](O)[C@H]([C@H](O)CC)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23O3P/c1-3-17(20)19(18(21)4-2)23(22,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h3,5-14,17-21H,1,4H2,2H3/t17-,18-,19-/m1/s1 |
| InChIKey | GKJYWUJWIAPQGJ-GUDVDZBRSA-N |
| XLogP | 2.69 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|