C21H25O3P — CID 11725813
(2E,4S,6S,7E)-5-diphenylphosphorylnona-2,7-diene-4,6-diol (PubChem CID 11725813) has the molecular formula C21H25O3P and a molecular weight of 356.40 g/mol. Its IUPAC name is (2E,4S,6S,7E)-5-diphenylphosphorylnona-2,7-diene-4,6-diol.
| Compound Name | (2E,4S,6S,7E)-5-diphenylphosphorylnona-2,7-diene-4,6-diol |
|---|---|
| PubChem CID | 11725813 |
| Molecular Formula | C21H25O3P |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (2E,4S,6S,7E)-5-diphenylphosphorylnona-2,7-diene-4,6-diol |
| SMILES | C/C=C/[C@H](O)C([C@@H](O)/C=C/C)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25O3P/c1-3-11-19(22)21(20(23)12-4-2)25(24,17-13-7-5-8-14-17)18-15-9-6-10-16-18/h3-16,19-23H,1-2H3/b11-3+,12-4+/t19-,20-/m0/s1 |
| InChIKey | FOIWPMPPQODTDO-XGLGDMSCSA-N |
| XLogP | 3.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|