C33H42O6P2 — CID 90418398
bis(diphenylphosphinic acid);4-methyloctane-3,5-diol (PubChem CID 90418398) has the molecular formula C33H42O6P2 and a molecular weight of 596.64 g/mol. Its IUPAC name is bis(diphenylphosphinic acid);4-methyloctane-3,5-diol.
| Compound Name | bis(diphenylphosphinic acid);4-methyloctane-3,5-diol |
|---|---|
| PubChem CID | 90418398 |
| Molecular Formula | C33H42O6P2 |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | bis(diphenylphosphinic acid);4-methyloctane-3,5-diol |
| SMILES | CCCC(O)C(C)C(O)CC.O=P(O)(c1ccccc1)c1ccccc1.O=P(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C12H11O2P.C9H20O2/c2*13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-4-6-9(11)7(3)8(10)5-2/h2*1-10H,(H,13,14);7-11H,4-6H2,1-3H3 |
| InChIKey | PLSWPUOXQXLRLR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|