C30H33O6P — CID 90415749
benzoic acid;diphenylphosphinic acid;2-methyl-1-phenylbutane-1,3-diol (PubChem CID 90415749) has the molecular formula C30H33O6P and a molecular weight of 520.56 g/mol. Its IUPAC name is benzoic acid;diphenylphosphinic acid;2-methyl-1-phenylbutane-1,3-diol.
| Compound Name | benzoic acid;diphenylphosphinic acid;2-methyl-1-phenylbutane-1,3-diol |
|---|---|
| PubChem CID | 90415749 |
| Molecular Formula | C30H33O6P |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | benzoic acid;diphenylphosphinic acid;2-methyl-1-phenylbutane-1,3-diol |
| SMILES | CC(O)C(C)C(O)c1ccccc1.O=C(O)c1ccccc1.O=P(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H11O2P.C11H16O2.C7H6O2/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-8(9(2)12)11(13)10-6-4-3-5-7-10;8-7(9)6-4-2-1-3-5-6/h1-10H,(H,13,14);3-9,11-13H,1-2H3;1-5H,(H,8,9) |
| InChIKey | CTTQPOCXQLVVRJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|