C28H25O2P — CID 102000616
(2S,3S)-2-diphenylphosphoryl-1,3-diphenylbutan-1-one (PubChem CID 102000616) has the molecular formula C28H25O2P and a molecular weight of 424.48 g/mol. Its IUPAC name is (2S,3S)-2-diphenylphosphoryl-1,3-diphenylbutan-1-one.
| Compound Name | (2S,3S)-2-diphenylphosphoryl-1,3-diphenylbutan-1-one |
|---|---|
| PubChem CID | 102000616 |
| Molecular Formula | C28H25O2P |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (2S,3S)-2-diphenylphosphoryl-1,3-diphenylbutan-1-one |
| SMILES | C[C@@H](c1ccccc1)[C@@H](C(=O)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H25O2P/c1-22(23-14-6-2-7-15-23)28(27(29)24-16-8-3-9-17-24)31(30,25-18-10-4-11-19-25)26-20-12-5-13-21-26/h2-22,28H,1H3/t22-,28-/m0/s1 |
| InChIKey | MTNHYTBHPTWKEW-DWACAAAGSA-N |
| XLogP | 6.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|