C25H27O2P — CID 10938003
1-[(1R,2S)-1-diphenylphosphoryl-2-phenylpropyl]cyclobutan-1-ol (PubChem CID 10938003) has the molecular formula C25H27O2P and a molecular weight of 390.46 g/mol. Its IUPAC name is 1-[(1R,2S)-1-diphenylphosphoryl-2-phenylpropyl]cyclobutan-1-ol.
| Compound Name | 1-[(1R,2S)-1-diphenylphosphoryl-2-phenylpropyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 10938003 |
| Molecular Formula | C25H27O2P |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[(1R,2S)-1-diphenylphosphoryl-2-phenylpropyl]cyclobutan-1-ol |
| SMILES | C[C@@H](c1ccccc1)[C@H](C1(O)CCC1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27O2P/c1-20(21-12-5-2-6-13-21)24(25(26)18-11-19-25)28(27,22-14-7-3-8-15-22)23-16-9-4-10-17-23/h2-10,12-17,20,24,26H,11,18-19H2,1H3/t20-,24+/m0/s1 |
| InChIKey | OVPVXMCZMIRARN-GBXCKJPGSA-N |
| XLogP | 5.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|