C21H27O2P — CID 10783487
1-(1-diphenylphosphorylpropyl)cyclohexan-1-ol (PubChem CID 10783487) has the molecular formula C21H27O2P and a molecular weight of 342.42 g/mol. Its IUPAC name is 1-(1-diphenylphosphorylpropyl)cyclohexan-1-ol.
| Compound Name | 1-(1-diphenylphosphorylpropyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 10783487 |
| Molecular Formula | C21H27O2P |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-(1-diphenylphosphorylpropyl)cyclohexan-1-ol |
| SMILES | CCC(C1(O)CCCCC1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27O2P/c1-2-20(21(22)16-10-5-11-17-21)24(23,18-12-6-3-7-13-18)19-14-8-4-9-15-19/h3-4,6-9,12-15,20,22H,2,5,10-11,16-17H2,1H3 |
| InChIKey | DVWOFNOTMPGKEH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|