C28H25O4P — CID 155683528
2-bis(4-methoxyphenyl)phosphoryl-1,2-diphenylethanone (PubChem CID 155683528) has the molecular formula C28H25O4P and a molecular weight of 456.48 g/mol. Its IUPAC name is 2-bis(4-methoxyphenyl)phosphoryl-1,2-diphenylethanone.
| Compound Name | 2-bis(4-methoxyphenyl)phosphoryl-1,2-diphenylethanone |
|---|---|
| PubChem CID | 155683528 |
| Molecular Formula | C28H25O4P |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 2-bis(4-methoxyphenyl)phosphoryl-1,2-diphenylethanone |
| SMILES | COc1ccc(P(=O)(c2ccc(OC)cc2)C(C(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25O4P/c1-31-23-13-17-25(18-14-23)33(30,26-19-15-24(32-2)16-20-26)28(22-11-7-4-8-12-22)27(29)21-9-5-3-6-10-21/h3-20,28H,1-2H3 |
| InChIKey | FFCIUVIOXNEPQC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|