C35H40O6P2+2 — CID 175697652
bis(dihydroxy(diphenyl)phosphanium);2-methyl-1-phenylbutane-1,3-diol (PubChem CID 175697652) has the molecular formula C35H40O6P2+2 and a molecular weight of 618.65 g/mol. Its IUPAC name is bis(dihydroxy(diphenyl)phosphanium);2-methyl-1-phenylbutane-1,3-diol.
| Compound Name | bis(dihydroxy(diphenyl)phosphanium);2-methyl-1-phenylbutane-1,3-diol |
|---|---|
| PubChem CID | 175697652 |
| Molecular Formula | C35H40O6P2+2 |
| Molecular Weight | 618.65 g/mol |
| Exact Mass | 618.23 |
| IUPAC Name | bis(dihydroxy(diphenyl)phosphanium);2-methyl-1-phenylbutane-1,3-diol |
| SMILES | CC(O)C(C)C(O)c1ccccc1.O[P+](O)(c1ccccc1)c1ccccc1.O[P+](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C12H12O2P.C11H16O2/c2*13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-8(9(2)12)11(13)10-6-4-3-5-7-10/h2*1-10,13-14H;3-9,11-13H,1-2H3/q2*+1; |
| InChIKey | ZFIJHTPVVMTBQN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|