C33H44O6P2+2 — CID 175697698
bis(dihydroxy(diphenyl)phosphanium);3,6-dimethylheptane-2,4-diol (PubChem CID 175697698) has the molecular formula C33H44O6P2+2 and a molecular weight of 598.66 g/mol. Its IUPAC name is bis(dihydroxy(diphenyl)phosphanium);3,6-dimethylheptane-2,4-diol.
| Compound Name | bis(dihydroxy(diphenyl)phosphanium);3,6-dimethylheptane-2,4-diol |
|---|---|
| PubChem CID | 175697698 |
| Molecular Formula | C33H44O6P2+2 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | bis(dihydroxy(diphenyl)phosphanium);3,6-dimethylheptane-2,4-diol |
| SMILES | CC(C)CC(O)C(C)C(C)O.O[P+](O)(c1ccccc1)c1ccccc1.O[P+](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C12H12O2P.C9H20O2/c2*13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-6(2)5-9(11)7(3)8(4)10/h2*1-10,13-14H;6-11H,5H2,1-4H3/q2*+1; |
| InChIKey | BFPDYYLQDOHLPC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|