C32H38O6P2+2 — CID 175697648
bis(dihydroxy(diphenyl)phosphanium);2,5-dimethylhex-3-yne-2,5-diol (PubChem CID 175697648) has the molecular formula C32H38O6P2+2 and a molecular weight of 580.60 g/mol. Its IUPAC name is bis(dihydroxy(diphenyl)phosphanium);2,5-dimethylhex-3-yne-2,5-diol.
| Compound Name | bis(dihydroxy(diphenyl)phosphanium);2,5-dimethylhex-3-yne-2,5-diol |
|---|---|
| PubChem CID | 175697648 |
| Molecular Formula | C32H38O6P2+2 |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | bis(dihydroxy(diphenyl)phosphanium);2,5-dimethylhex-3-yne-2,5-diol |
| SMILES | CC(C)(O)C#CC(C)(C)O.O[P+](O)(c1ccccc1)c1ccccc1.O[P+](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C12H12O2P.C8H14O2/c2*13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-7(2,9)5-6-8(3,4)10/h2*1-10,13-14H;9-10H,1-4H3/q2*+1; |
| InChIKey | JGRMRSMLZWEKER-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|