C20H22O2 — CID 71489134
5,5-dimethyl-1,1-diphenylhex-2-yne-1,4-diol (PubChem CID 71489134) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 5,5-dimethyl-1,1-diphenylhex-2-yne-1,4-diol.
| Compound Name | 5,5-dimethyl-1,1-diphenylhex-2-yne-1,4-diol |
|---|---|
| PubChem CID | 71489134 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 5,5-dimethyl-1,1-diphenylhex-2-yne-1,4-diol |
| SMILES | CC(C)(C)C(O)C#CC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22O2/c1-19(2,3)18(21)14-15-20(22,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,18,21-22H,1-3H3 |
| InChIKey | DTWGRQPMRGVGDG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|