About (4R)-4-anthracen-2-yl-1,1-diphenylpent-2-yn-1-ol
(4R)-4-anthracen-2-yl-1,1-diphenylpent-2-yn-1-ol (PubChem CID 86338505) has the molecular formula C31H24O
and a molecular weight of 412.53 g/mol. Its IUPAC name is (4R)-4-anthracen-2-yl-1,1-diphenylpent-2-yn-1-ol.
Molecular Properties
| Compound Name | (4R)-4-anthracen-2-yl-1,1-diphenylpent-2-yn-1-ol |
| PubChem CID | 86338505 |
| Molecular Formula | C31H24O |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | (4R)-4-anthracen-2-yl-1,1-diphenylpent-2-yn-1-ol |
| SMILES | C[C@@H](C#CC(O)(c1ccccc1)c1ccccc1)c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C31H24O/c1-23(24-16-17-27-21-25-10-8-9-11-26(25)22-28(27)20-24)18-19-31(32,29-12-4-2-5-13-29)30-14-6-3-7-15-30/h2-17,20-23,32H,1H3/t23-/m0/s1 |
| InChIKey | ITVMIASCSFHJJJ-QHCPKHFHSA-N |
| XLogP | 7.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-anthracen-2-yl-1,1-diphenylpent-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-anthracen-2-yl-1,1-diphenylpent-2-yn-1-ol?
The IUPAC name of (4R)-4-anthracen-2-yl-1,1-diphenylpent-2-yn-1-ol (CID 86338505) is (4R)-4-anthracen-2-yl-1,1-diphenylpent-2-yn-1-ol.
What is the SMILES notation for (4R)-4-anthracen-2-yl-1,1-diphenylpent-2-yn-1-ol?
The canonical SMILES for (4R)-4-anthracen-2-yl-1,1-diphenylpent-2-yn-1-ol is C[C@@H](C#CC(O)(c1ccccc1)c1ccccc1)c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of (4R)-4-anthracen-2-yl-1,1-diphenylpent-2-yn-1-ol?
The InChIKey is ITVMIASCSFHJJJ-QHCPKHFHSA-N. The full InChI is InChI=1S/C31H24O/c1-23(24-16-17-27-21-25-10-8-9-11-26(25)22-28(27)20-24)18-19-31(32,29-12-4-2-5-13-29)30-14-6-3-7-15-30/h2-17,20-23,32H,1H3/t23-/m0/s1.
What are the key properties of (4R)-4-anthracen-2-yl-1,1-diphenylpent-2-yn-1-ol?
(4R)-4-anthracen-2-yl-1,1-diphenylpent-2-yn-1-ol has a molecular weight of 412.53 g/mol, XLogP of 7.04, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-anthracen-2-yl-1,1-diphenylpent-2-yn-1-ol is sourced from PubChem (CID 86338505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).