C17H18O — CID 178185600
(2R,3R)-3-methyl-2-naphthalen-2-ylhex-5-yn-3-ol (PubChem CID 178185600) has the molecular formula C17H18O and a molecular weight of 238.33 g/mol. Its IUPAC name is (2R,3R)-3-methyl-2-naphthalen-2-ylhex-5-yn-3-ol.
| Compound Name | (2R,3R)-3-methyl-2-naphthalen-2-ylhex-5-yn-3-ol |
|---|---|
| PubChem CID | 178185600 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (2R,3R)-3-methyl-2-naphthalen-2-ylhex-5-yn-3-ol |
| SMILES | C#CC[C@@](C)(O)[C@H](C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H18O/c1-4-11-17(3,18)13(2)15-10-9-14-7-5-6-8-16(14)12-15/h1,5-10,12-13,18H,11H2,2-3H3/t13-,17-/m1/s1 |
| InChIKey | BJSQPBSIKZPWSC-CXAGYDPISA-N |
| XLogP | 3.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|