C18H23NO2 — CID 79263498
2-[tert-butyl(1-naphthalen-2-ylethyl)amino]acetic acid (PubChem CID 79263498) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[tert-butyl(1-naphthalen-2-ylethyl)amino]acetic acid.
| Compound Name | 2-[tert-butyl(1-naphthalen-2-ylethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79263498 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-[tert-butyl(1-naphthalen-2-ylethyl)amino]acetic acid |
| SMILES | CC(c1ccc2ccccc2c1)N(CC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C18H23NO2/c1-13(19(12-17(20)21)18(2,3)4)15-10-9-14-7-5-6-8-16(14)11-15/h5-11,13H,12H2,1-4H3,(H,20,21) |
| InChIKey | PDVGBDKKFASGHA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |