C16H19NO3 — CID 125470025
(3R)-3-[[(2R)-2-hydroxy-2-naphthalen-2-ylethyl]amino]butanoic acid (PubChem CID 125470025) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is (3R)-3-[[(2R)-2-hydroxy-2-naphthalen-2-ylethyl]amino]butanoic acid.
| Compound Name | (3R)-3-[[(2R)-2-hydroxy-2-naphthalen-2-ylethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 125470025 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (3R)-3-[[(2R)-2-hydroxy-2-naphthalen-2-ylethyl]amino]butanoic acid |
| SMILES | C[C@H](CC(=O)O)NC[C@H](O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H19NO3/c1-11(8-16(19)20)17-10-15(18)14-7-6-12-4-2-3-5-13(12)9-14/h2-7,9,11,15,17-18H,8,10H2,1H3,(H,19,20)/t11-,15+/m1/s1 |
| InChIKey | BLUZGLHZYIYPSX-ABAIWWIYSA-N |
| XLogP | 2.33 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |