C17H23NO2 — CID 79250265
(2S)-2-[(2-hydroxy-2-naphthalen-2-ylethyl)amino]-3-methylbutan-1-ol (PubChem CID 79250265) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (2S)-2-[(2-hydroxy-2-naphthalen-2-ylethyl)amino]-3-methylbutan-1-ol.
| Compound Name | (2S)-2-[(2-hydroxy-2-naphthalen-2-ylethyl)amino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 79250265 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (2S)-2-[(2-hydroxy-2-naphthalen-2-ylethyl)amino]-3-methylbutan-1-ol |
| SMILES | CC(C)[C@@H](CO)NCC(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H23NO2/c1-12(2)16(11-19)18-10-17(20)15-8-7-13-5-3-4-6-14(13)9-15/h3-9,12,16-20H,10-11H2,1-2H3/t16-,17?/m1/s1 |
| InChIKey | VWSCHXNMIZXHKM-TZHYSIJRSA-N |
| XLogP | 2.48 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |