C16H19NO — CID 124593831
(1R)-2-[[(2S)-but-3-en-2-yl]amino]-1-naphthalen-2-ylethanol (PubChem CID 124593831) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is (1R)-2-[[(2S)-but-3-en-2-yl]amino]-1-naphthalen-2-ylethanol.
| Compound Name | (1R)-2-[[(2S)-but-3-en-2-yl]amino]-1-naphthalen-2-ylethanol |
|---|---|
| PubChem CID | 124593831 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (1R)-2-[[(2S)-but-3-en-2-yl]amino]-1-naphthalen-2-ylethanol |
| SMILES | C=C[C@H](C)NC[C@H](O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H19NO/c1-3-12(2)17-11-16(18)15-9-8-13-6-4-5-7-14(13)10-15/h3-10,12,16-18H,1,11H2,2H3/t12-,16-/m0/s1 |
| InChIKey | YIAFZQFLOCLOCH-LRDDRELGSA-N |
| XLogP | 3.04 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|