C31H22Cl2O3 — CID 11145688
(1S,7S)-1,7-bis(2-chlorophenyl)-1,7-diphenylhepta-2,5-diyne-1,4,7-triol (PubChem CID 11145688) has the molecular formula C31H22Cl2O3 and a molecular weight of 513.42 g/mol. Its IUPAC name is (1S,7S)-1,7-bis(2-chlorophenyl)-1,7-diphenylhepta-2,5-diyne-1,4,7-triol.
| Compound Name | (1S,7S)-1,7-bis(2-chlorophenyl)-1,7-diphenylhepta-2,5-diyne-1,4,7-triol |
|---|---|
| PubChem CID | 11145688 |
| Molecular Formula | C31H22Cl2O3 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | (1S,7S)-1,7-bis(2-chlorophenyl)-1,7-diphenylhepta-2,5-diyne-1,4,7-triol |
| SMILES | OC(C#C[C@@](O)(c1ccccc1)c1ccccc1Cl)C#C[C@@](O)(c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C31H22Cl2O3/c32-28-17-9-7-15-26(28)30(35,23-11-3-1-4-12-23)21-19-25(34)20-22-31(36,24-13-5-2-6-14-24)27-16-8-10-18-29(27)33/h1-18,25,34-36H/t30-,31-/m1/s1 |
| InChIKey | NOPKRWQXLVUAPN-FIRIVFDPSA-N |
| XLogP | 5.53 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|