C16H16O2S — CID 751171
(1S)-4-methyl-1-phenyl-1-thiophen-2-ylpent-2-yne-1,4-diol (PubChem CID 751171) has the molecular formula C16H16O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is (1S)-4-methyl-1-phenyl-1-thiophen-2-ylpent-2-yne-1,4-diol.
| Compound Name | (1S)-4-methyl-1-phenyl-1-thiophen-2-ylpent-2-yne-1,4-diol |
|---|---|
| PubChem CID | 751171 |
| Molecular Formula | C16H16O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (1S)-4-methyl-1-phenyl-1-thiophen-2-ylpent-2-yne-1,4-diol |
| SMILES | CC(C)(O)C#C[C@@](O)(c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C16H16O2S/c1-15(2,17)10-11-16(18,14-9-6-12-19-14)13-7-4-3-5-8-13/h3-9,12,17-18H,1-2H3/t16-/m1/s1 |
| InChIKey | HVKSMKKAFOYNMX-MRXNPFEDSA-N |
| XLogP | 2.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|