C17H21NO2S — CID 111825074
N-(2-hydroxy-2-phenylpropyl)-2-methyl-2-thiophen-2-ylpropanamide (PubChem CID 111825074) has the molecular formula C17H21NO2S and a molecular weight of 303.43 g/mol. Its IUPAC name is N-(2-hydroxy-2-phenylpropyl)-2-methyl-2-thiophen-2-ylpropanamide.
| Compound Name | N-(2-hydroxy-2-phenylpropyl)-2-methyl-2-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 111825074 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-(2-hydroxy-2-phenylpropyl)-2-methyl-2-thiophen-2-ylpropanamide |
| SMILES | CC(O)(CNC(=O)C(C)(C)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C17H21NO2S/c1-16(2,14-10-7-11-21-14)15(19)18-12-17(3,20)13-8-5-4-6-9-13/h4-11,20H,12H2,1-3H3,(H,18,19) |
| InChIKey | ANZHINMDDSBSNX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |