C12H19O2PS — CID 13048789
1-[ethylsulfanyl(phenyl)phosphoryl]butan-1-ol (PubChem CID 13048789) has the molecular formula C12H19O2PS and a molecular weight of 258.32 g/mol. Its IUPAC name is 1-[ethylsulfanyl(phenyl)phosphoryl]butan-1-ol.
| Compound Name | 1-[ethylsulfanyl(phenyl)phosphoryl]butan-1-ol |
|---|---|
| PubChem CID | 13048789 |
| Molecular Formula | C12H19O2PS |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 1-[ethylsulfanyl(phenyl)phosphoryl]butan-1-ol |
| SMILES | CCCC(O)P(=O)(SCC)c1ccccc1 |
| InChI | InChI=1S/C12H19O2PS/c1-3-8-12(13)15(14,16-4-2)11-9-6-5-7-10-11/h5-7,9-10,12-13H,3-4,8H2,1-2H3 |
| InChIKey | IZBPUDMONFWVBE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|