C12H17NO — CID 76974159
1-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-2-(methylamino)pentan-1-one (PubChem CID 76974159) has the molecular formula C12H17NO and a molecular weight of 197.23 g/mol. Its IUPAC name is 1-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-2-(methylamino)pentan-1-one.
| Compound Name | 1-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-2-(methylamino)pentan-1-one |
|---|---|
| PubChem CID | 76974159 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 1-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-2-(methylamino)pentan-1-one |
| SMILES | CCCC(NC)C(=O)[13c]1[13cH][13cH][13cH][13cH][13cH]1 |
| InChI | InChI=1S/C12H17NO/c1-3-7-11(13-2)12(14)10-8-5-4-6-9-10/h4-6,8-9,11,13H,3,7H2,1-2H3/i4+1,5+1,6+1,8+1,9+1,10+1 |
| InChIKey | WLIWIUNEJRETFX-JRCSFSBYSA-N |
| XLogP | 2.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |