C10H12O5 — CID 66852156
2,3,4,4-tetrahydroxy-1-phenylbutan-1-one (PubChem CID 66852156) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is 2,3,4,4-tetrahydroxy-1-phenylbutan-1-one.
| Compound Name | 2,3,4,4-tetrahydroxy-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 66852156 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2,3,4,4-tetrahydroxy-1-phenylbutan-1-one |
| SMILES | O=C(c1ccccc1)C(O)C(O)C(O)O |
| InChI | InChI=1S/C10H12O5/c11-7(6-4-2-1-3-5-6)8(12)9(13)10(14)15/h1-5,8-10,12-15H |
| InChIKey | JDWSQKPEWXRAAG-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|